C19H38N4O3 — CID 111789922
ethyl 4-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111789922) has the molecular formula C19H38N4O3 and a molecular weight of 370.54 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111789922 |
| Molecular Formula | C19H38N4O3 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[2-(2-hydroxyethyl)-4-methylpentyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H38N4O3/c1-5-20-18(21-14-16(9-12-24)13-15(3)4)22-17-7-10-23(11-8-17)19(25)26-6-2/h15-17,24H,5-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | PMPOHPZZOBREJJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|