C19H26BrIN4 — CID 111790331
1-[2-[(3-bromophenyl)methyl]butyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111790331) has the molecular formula C19H26BrIN4 and a molecular weight of 517.25 g/mol. Its IUPAC name is 1-[2-[(3-bromophenyl)methyl]butyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[(3-bromophenyl)methyl]butyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111790331 |
| Molecular Formula | C19H26BrIN4 |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 1-[2-[(3-bromophenyl)methyl]butyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCC(CN/C(=N/C)NCc1ccccn1)Cc1cccc(Br)c1.I |
| InChI | InChI=1S/C19H25BrN4.HI/c1-3-15(11-16-7-6-8-17(20)12-16)13-23-19(21-2)24-14-18-9-4-5-10-22-18;/h4-10,12,15H,3,11,13-14H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | BANJPIFFXWFXFP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|