C27H25F2N3OS — CID 11179049
N-(cyanomethyl)-5,5-difluoro-2-[2-[4-(pyridin-2-ylmethylsulfanyl)phenyl]phenyl]cyclohexane-1-carboxamide (PubChem CID 11179049) has the molecular formula C27H25F2N3OS and a molecular weight of 477.58 g/mol. Its IUPAC name is N-(cyanomethyl)-5,5-difluoro-2-[2-[4-(pyridin-2-ylmethylsulfanyl)phenyl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | N-(cyanomethyl)-5,5-difluoro-2-[2-[4-(pyridin-2-ylmethylsulfanyl)phenyl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11179049 |
| Molecular Formula | C27H25F2N3OS |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-(cyanomethyl)-5,5-difluoro-2-[2-[4-(pyridin-2-ylmethylsulfanyl)phenyl]phenyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)C1CC(F)(F)CCC1c1ccccc1-c1ccc(SCc2ccccn2)cc1 |
| InChI | InChI=1S/C27H25F2N3OS/c28-27(29)13-12-24(25(17-27)26(33)32-16-14-30)23-7-2-1-6-22(23)19-8-10-21(11-9-19)34-18-20-5-3-4-15-31-20/h1-11,15,24-25H,12-13,16-18H2,(H,32,33) |
| InChIKey | NZSYSGXZZVLJTR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|