C17H23N5O — CID 111792235
2-methyl-1-(oxolan-2-ylmethyl)-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine (PubChem CID 111792235) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethyl)-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111792235 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-[(3-pyrazol-1-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(-n2cccn2)c1)NCC1CCCO1 |
| InChI | InChI=1S/C17H23N5O/c1-18-17(20-13-16-7-3-10-23-16)19-12-14-5-2-6-15(11-14)22-9-4-8-21-22/h2,4-6,8-9,11,16H,3,7,10,12-13H2,1H3,(H2,18,19,20) |
| InChIKey | FLGUXYOTOCGZES-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|