C20H28IN3O5 — CID 111792462
1-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111792462) has the molecular formula C20H28IN3O5 and a molecular weight of 517.36 g/mol. Its IUPAC name is 1-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792462 |
| Molecular Formula | C20H28IN3O5 |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)ccc1O)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C20H27N3O5.HI/c1-6-21-20(22-12-13-9-15(25-2)7-8-16(13)24)23-14-10-17(26-3)19(28-5)18(11-14)27-4;/h7-11,24H,6,12H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | UUPOSBCYWUCPNL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|