C18H27IN4O4 — CID 111792492
2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111792492) has the molecular formula C18H27IN4O4 and a molecular weight of 490.34 g/mol. Its IUPAC name is 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792492 |
| Molecular Formula | C18H27IN4O4 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C18H26N4O4.HI/c1-11(2)14-9-13(26-22-14)10-20-18(19-3)21-12-7-15(23-4)17(25-6)16(8-12)24-5;/h7-9,11H,10H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | SMXUOICAVSNDGO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|