C20H24FN3O — CID 111796521
2-[[1-(2-fluorophenyl)cyclopropyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine (PubChem CID 111796521) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)cyclopropyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine.
| Compound Name | 2-[[1-(2-fluorophenyl)cyclopropyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111796521 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)cyclopropyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CC1(c2ccccc2F)CC1)NCCc1ccco1 |
| InChI | InChI=1S/C20H24FN3O/c1-2-12-22-19(23-13-9-16-6-5-14-25-16)24-15-20(10-11-20)17-7-3-4-8-18(17)21/h2-8,14H,1,9-13,15H2,(H2,22,23,24) |
| InChIKey | KZCXPHYRTWKMQG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|