C24H29IN6O — CID 111798369
1-ethyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111798369) has the molecular formula C24H29IN6O and a molecular weight of 544.44 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111798369 |
| Molecular Formula | C24H29IN6O |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 1-ethyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-2-[(3-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-n2cccn2)c1)NCc1ccc(N2CCCC2=O)cc1.I |
| InChI | InChI=1S/C24H28N6O.HI/c1-2-25-24(27-18-20-6-3-7-22(16-20)30-15-5-13-28-30)26-17-19-9-11-21(12-10-19)29-14-4-8-23(29)31;/h3,5-7,9-13,15-16H,2,4,8,14,17-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | QPJCWBXRXLVIPP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|