C17H22N2O3 — CID 111798808
N'-(1-cyclopropyl-3-hydroxypropyl)-N-(2,3-dihydro-1H-inden-5-yl)oxamide (PubChem CID 111798808) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N'-(1-cyclopropyl-3-hydroxypropyl)-N-(2,3-dihydro-1H-inden-5-yl)oxamide.
| Compound Name | N'-(1-cyclopropyl-3-hydroxypropyl)-N-(2,3-dihydro-1H-inden-5-yl)oxamide |
|---|---|
| PubChem CID | 111798808 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N'-(1-cyclopropyl-3-hydroxypropyl)-N-(2,3-dihydro-1H-inden-5-yl)oxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)C(=O)NC(CCO)C1CC1 |
| InChI | InChI=1S/C17H22N2O3/c20-9-8-15(12-4-5-12)19-17(22)16(21)18-14-7-6-11-2-1-3-13(11)10-14/h6-7,10,12,15,20H,1-5,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | HVMBNUDNFOCCCG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|