C15H22N2O3 — CID 111798967
N-(2,5-dimethylphenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide (PubChem CID 111798967) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide |
|---|---|
| PubChem CID | 111798967 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NC(C)C(C)CO)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-9-5-6-10(2)13(7-9)17-15(20)14(19)16-12(4)11(3)8-18/h5-7,11-12,18H,8H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | DCFBDYHXYJMLAS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|