C29H40O8Si — CID 11180313
tert-butyl (3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-[3-(methoxymethoxy)propanoyloxy]-2-oxobutanoate (PubChem CID 11180313) has the molecular formula C29H40O8Si and a molecular weight of 544.72 g/mol. Its IUPAC name is tert-butyl (3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-[3-(methoxymethoxy)propanoyloxy]-2-oxobutanoate.
| Compound Name | tert-butyl (3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-[3-(methoxymethoxy)propanoyloxy]-2-oxobutanoate |
|---|---|
| PubChem CID | 11180313 |
| Molecular Formula | C29H40O8Si |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | tert-butyl (3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-[3-(methoxymethoxy)propanoyloxy]-2-oxobutanoate |
| SMILES | COCOCCC(=O)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40O8Si/c1-28(2,3)37-27(32)26(31)24(36-25(30)18-19-34-21-33-7)20-35-38(29(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,24H,18-21H2,1-7H3/t24-/m1/s1 |
| InChIKey | MESRIDDYKFZTDL-XMMPIXPASA-N |
| XLogP | 3.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|