C24H32O4Si — CID 23635811
(4S,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 23635811) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is (4S,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 23635811 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (4S,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C=O)O1 |
| InChI | InChI=1S/C24H32O4Si/c1-23(2,3)29(19-12-8-6-9-13-19,20-14-10-7-11-15-20)26-17-16-21-22(18-25)28-24(4,5)27-21/h6-15,18,21-22H,16-17H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | OPQBSYWKQNFTOD-FCHUYYIVSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|