C28H31O8PS — CID 11180463
benzyl 2-[(2R)-2-acetyloxy-3-bis(phenylmethoxy)phosphoryloxypropyl]sulfanylacetate (PubChem CID 11180463) has the molecular formula C28H31O8PS and a molecular weight of 558.59 g/mol. Its IUPAC name is benzyl 2-[(2R)-2-acetyloxy-3-bis(phenylmethoxy)phosphoryloxypropyl]sulfanylacetate.
| Compound Name | benzyl 2-[(2R)-2-acetyloxy-3-bis(phenylmethoxy)phosphoryloxypropyl]sulfanylacetate |
|---|---|
| PubChem CID | 11180463 |
| Molecular Formula | C28H31O8PS |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | benzyl 2-[(2R)-2-acetyloxy-3-bis(phenylmethoxy)phosphoryloxypropyl]sulfanylacetate |
| SMILES | CC(=O)O[C@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)CSCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H31O8PS/c1-23(29)36-27(21-38-22-28(30)32-17-24-11-5-2-6-12-24)20-35-37(31,33-18-25-13-7-3-8-14-25)34-19-26-15-9-4-10-16-26/h2-16,27H,17-22H2,1H3/t27-/m1/s1 |
| InChIKey | WZDXEXPZTFDSDG-HHHXNRCGSA-N |
| XLogP | 5.95 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|