C23H31N3O4 — CID 111811404
1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine (PubChem CID 111811404) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111811404 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2cccc(OC)c2OC2CCCC2)cc1OC |
| InChI | InChI=1S/C23H31N3O4/c1-27-19-12-11-16(13-21(19)29-3)14-25-23(24)26-15-17-7-6-10-20(28-2)22(17)30-18-8-4-5-9-18/h6-7,10-13,18H,4-5,8-9,14-15H2,1-3H3,(H3,24,25,26) |
| InChIKey | NAMBWMXRSGJNLZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|