C22H29N3O3 — CID 111049398
1-[(2-cyclopentyloxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine (PubChem CID 111049398) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(2-cyclopentyloxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111049398 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-[(2-cyclopentyloxyphenyl)methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccccc2OC2CCCC2)cc1OC |
| InChI | InChI=1S/C22H29N3O3/c1-26-20-12-11-16(13-21(20)27-2)14-24-22(23)25-15-17-7-3-6-10-19(17)28-18-8-4-5-9-18/h3,6-7,10-13,18H,4-5,8-9,14-15H2,1-2H3,(H3,23,24,25) |
| InChIKey | RGQUBCVAAFYXQC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|