C21H30N4O4S — CID 111082257
1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine (PubChem CID 111082257) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111082257 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccccc2S(=O)(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C21H30N4O4S/c1-21(2,3)25-30(26,27)19-9-7-6-8-16(19)14-24-20(22)23-13-15-10-11-17(28-4)18(12-15)29-5/h6-12,25H,13-14H2,1-5H3,(H3,22,23,24) |
| InChIKey | AQEUHTZRNDHTQU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|