C33H44N2O9S — CID 11181284
2-[[4-[2-(1,1-diphenylethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 11181284) has the molecular formula C33H44N2O9S and a molecular weight of 644.79 g/mol. Its IUPAC name is 2-[[4-[2-(1,1-diphenylethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 2-[[4-[2-(1,1-diphenylethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11181284 |
| Molecular Formula | C33H44N2O9S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 2-[[4-[2-(1,1-diphenylethylsulfanyl)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CC(SCCN1CCOc2c(OCC(=O)O)cccc21)(c1ccccc1)c1ccccc1.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C26H27NO4S.C7H17NO5/c1-26(20-9-4-2-5-10-20,21-11-6-3-7-12-21)32-18-16-27-15-17-30-25-22(27)13-8-14-23(25)31-19-24(28)29;1-8-2-4(10)6(12)7(13)5(11)3-9/h2-14H,15-19H2,1H3,(H,28,29);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | PGSFVHDYNOMCIC-WZTVWXICSA-N |
| XLogP | 1.69 |
| TPSA | 172.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |