C25H23N3O7 — CID 58602833
2-[[4-[2-(N-(4-nitrobenzoyl)anilino)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid (PubChem CID 58602833) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[[4-[2-(N-(4-nitrobenzoyl)anilino)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid.
| Compound Name | 2-[[4-[2-(N-(4-nitrobenzoyl)anilino)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 58602833 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[[4-[2-(N-(4-nitrobenzoyl)anilino)ethyl]-2,3-dihydro-1,4-benzoxazin-8-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1OCCN2CCN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O7/c29-23(30)17-35-22-8-4-7-21-24(22)34-16-15-26(21)13-14-27(19-5-2-1-3-6-19)25(31)18-9-11-20(12-10-18)28(32)33/h1-12H,13-17H2,(H,29,30) |
| InChIKey | NBVUHXRRZKMPGC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|