C17H29N3 — CID 111813102
2-(2,2-dimethyl-5-phenylpentyl)-1-propan-2-ylguanidine (PubChem CID 111813102) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5-phenylpentyl)-1-propan-2-ylguanidine.
| Compound Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111813102 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CC(C)(C)CCCc1ccccc1 |
| InChI | InChI=1S/C17H29N3/c1-14(2)20-16(18)19-13-17(3,4)12-8-11-15-9-6-5-7-10-15/h5-7,9-10,14H,8,11-13H2,1-4H3,(H3,18,19,20) |
| InChIKey | WROBSDRBXKQRHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|