C18H32IN3O — CID 111813103
2-(2,2-dimethyl-5-phenylpentyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 111813103) has the molecular formula C18H32IN3O and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5-phenylpentyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813103 |
| Molecular Formula | C18H32IN3O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CC(C)(C)CCCc1ccccc1.I |
| InChI | InChI=1S/C18H31N3O.HI/c1-15(13-22-4)21-17(19)20-14-18(2,3)12-8-11-16-9-6-5-7-10-16;/h5-7,9-10,15H,8,11-14H2,1-4H3,(H3,19,20,21);1H |
| InChIKey | AWELOICPABWAHF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|