C13H22IN3O3S — CID 111065155
2-[2-(benzenesulfonyl)ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 111065155) has the molecular formula C13H22IN3O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065155 |
| Molecular Formula | C13H22IN3O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C13H21N3O3S.HI/c1-11(10-19-2)16-13(14)15-8-9-20(17,18)12-6-4-3-5-7-12;/h3-7,11H,8-10H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | PRUSJZVFFPEIGZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|