C18H32IN3O2S — CID 111204507
2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide (PubChem CID 111204507) has the molecular formula C18H32IN3O2S and a molecular weight of 481.44 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111204507 |
| Molecular Formula | C18H32IN3O2S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)NC(C)CCC(C)C.I |
| InChI | InChI=1S/C18H31N3O2S.HI/c1-5-19-18(21-16(4)12-11-15(2)3)20-13-14-24(22,23)17-9-7-6-8-10-17;/h6-10,15-16H,5,11-14H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | NGUCXJWRCDXXHB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|