C13H20BrN3O2S — CID 111117605
2-[2-(4-bromophenyl)sulfonylethyl]-1,3-diethylguanidine (PubChem CID 111117605) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfonylethyl]-1,3-diethylguanidine.
| Compound Name | 2-[2-(4-bromophenyl)sulfonylethyl]-1,3-diethylguanidine |
|---|---|
| PubChem CID | 111117605 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfonylethyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NCCS(=O)(=O)c1ccc(Br)cc1)NCC |
| InChI | InChI=1S/C13H20BrN3O2S/c1-3-15-13(16-4-2)17-9-10-20(18,19)12-7-5-11(14)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | VJYAFCFULDHCJI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|