C15H24IN3O3 — CID 111040660
methyl 4-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]benzoate;hydroiodide (PubChem CID 111040660) has the molecular formula C15H24IN3O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is methyl 4-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111040660 |
| Molecular Formula | C15H24IN3O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl 4-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]benzoate;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C15H23N3O3.HI/c1-11(10-20-2)18-15(16)17-9-8-12-4-6-13(7-5-12)14(19)21-3;/h4-7,11H,8-10H2,1-3H3,(H3,16,17,18);1H |
| InChIKey | WOBKZXHJXAMOMF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|