C15H24N4O2 — CID 111817584
3-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide (PubChem CID 111817584) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111817584 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]ethyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CC/N=C(\N)NC(C)COC)c1 |
| InChI | InChI=1S/C15H24N4O2/c1-11(10-21-3)19-15(16)18-8-7-12-5-4-6-13(9-12)14(20)17-2/h4-6,9,11H,7-8,10H2,1-3H3,(H,17,20)(H3,16,18,19) |
| InChIKey | HLLLATUATXYSHN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|