C17H33N3O — CID 111815658
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-octylguanidine (PubChem CID 111815658) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-octylguanidine.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-octylguanidine |
|---|---|
| PubChem CID | 111815658 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-octylguanidine |
| SMILES | CCCCCCCC/N=C(\N)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C17H33N3O/c1-4-5-6-7-8-9-11-19-16(18)20-14-13-10-12-21-15(13)17(14,2)3/h13-15H,4-12H2,1-3H3,(H3,18,19,20) |
| InChIKey | QKESBVOHJPDULB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|