C24H34ClIN4O2 — CID 111818153
2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111818153) has the molecular formula C24H34ClIN4O2 and a molecular weight of 572.92 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111818153 |
| Molecular Formula | C24H34ClIN4O2 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC2CCCN(C)C2c2cccc(Cl)c2)cc1OC.I |
| InChI | InChI=1S/C24H33ClN4O2.HI/c1-29-13-5-7-19(23(29)18-6-4-8-20(25)15-18)16-28-24(26)27-12-11-17-9-10-21(30-2)22(14-17)31-3;/h4,6,8-10,14-15,19,23H,5,7,11-13,16H2,1-3H3,(H3,26,27,28);1H |
| InChIKey | YYLPSSIUYGMBMK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|