C19H30ClIN4 — CID 111818173
N'-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111818173) has the molecular formula C19H30ClIN4 and a molecular weight of 476.83 g/mol. Its IUPAC name is N'-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111818173 |
| Molecular Formula | C19H30ClIN4 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N'-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CN1CCCC(C/N=C(\N)N2CCCCC2)C1c1cccc(Cl)c1.I |
| InChI | InChI=1S/C19H29ClN4.HI/c1-23-10-6-8-16(18(23)15-7-5-9-17(20)13-15)14-22-19(21)24-11-3-2-4-12-24;/h5,7,9,13,16,18H,2-4,6,8,10-12,14H2,1H3,(H2,21,22);1H |
| InChIKey | CPQZEJQFUVDYCS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|