C21H27F3IN5 — CID 111819239
1-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111819239) has the molecular formula C21H27F3IN5 and a molecular weight of 533.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111819239 |
| Molecular Formula | C21H27F3IN5 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 1-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cc(C(F)(F)F)ccc2N2CCN(C)CC2)cc1.I |
| InChI | InChI=1S/C21H26F3N5.HI/c1-15-3-6-18(7-4-15)27-20(25)26-14-16-13-17(21(22,23)24)5-8-19(16)29-11-9-28(2)10-12-29;/h3-8,13H,9-12,14H2,1-2H3,(H3,25,26,27);1H |
| InChIKey | GDUDKQZIQABDTI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|