C12H21IN4O3 — CID 111821880
N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111821880) has the molecular formula C12H21IN4O3 and a molecular weight of 396.23 g/mol. Its IUPAC name is N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111821880 |
| Molecular Formula | C12H21IN4O3 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N'-[2-(2,6-dioxopiperidin-1-yl)ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCN1C(=O)CCCC1=O)N1CCOCC1 |
| InChI | InChI=1S/C12H20N4O3.HI/c13-12(15-6-8-19-9-7-15)14-4-5-16-10(17)2-1-3-11(16)18;/h1-9H2,(H2,13,14);1H |
| InChIKey | WHMSORLDKGNLOT-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|