C24H28IN3O3 — CID 111821982
1-(2,5-dimethoxyphenyl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine;hydroiodide (PubChem CID 111821982) has the molecular formula C24H28IN3O3 and a molecular weight of 533.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111821982 |
| Molecular Formula | C24H28IN3O3 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC(O)(Cc2ccccc2)c2ccccc2)c1.I |
| InChI | InChI=1S/C24H27N3O3.HI/c1-29-20-13-14-22(30-2)21(15-20)27-23(25)26-17-24(28,19-11-7-4-8-12-19)16-18-9-5-3-6-10-18;/h3-15,28H,16-17H2,1-2H3,(H3,25,26,27);1H |
| InChIKey | OWYKMNRQDYGQFA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|