C15H28N4S — CID 111822130
2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-octylguanidine (PubChem CID 111822130) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-octylguanidine.
| Compound Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-octylguanidine |
|---|---|
| PubChem CID | 111822130 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-octylguanidine |
| SMILES | CCCCCCCCN/C(N)=N/Cc1ncc(CC)s1 |
| InChI | InChI=1S/C15H28N4S/c1-3-5-6-7-8-9-10-17-15(16)19-12-14-18-11-13(4-2)20-14/h11H,3-10,12H2,1-2H3,(H3,16,17,19) |
| InChIKey | SLPVDKZYMRHARY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|