C10H17BrIN3S — CID 111066948
2-[(5-bromothiophen-2-yl)methyl]-1-butylguanidine;hydroiodide (PubChem CID 111066948) has the molecular formula C10H17BrIN3S and a molecular weight of 418.14 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-butylguanidine;hydroiodide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-butylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111066948 |
| Molecular Formula | C10H17BrIN3S |
| Molecular Weight | 418.14 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-butylguanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C10H16BrN3S.HI/c1-2-3-6-13-10(12)14-7-8-4-5-9(11)15-8;/h4-5H,2-3,6-7H2,1H3,(H3,12,13,14);1H |
| InChIKey | QGQIZHIWDOTBJV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|