C11H21IN4S — CID 111822141
2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111822141) has the molecular formula C11H21IN4S and a molecular weight of 368.29 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111822141 |
| Molecular Formula | C11H21IN4S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN=C(N(C)C)N(C)C)s1.I |
| InChI | InChI=1S/C11H20N4S.HI/c1-6-9-7-12-10(16-9)8-13-11(14(2)3)15(4)5;/h7H,6,8H2,1-5H3;1H |
| InChIKey | QKFJBWBBVFGPPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|