C18H33F3IN5O2 — CID 111822498
ethyl 4-[[N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111822498) has the molecular formula C18H33F3IN5O2 and a molecular weight of 535.39 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111822498 |
| Molecular Formula | C18H33F3IN5O2 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 4-[[N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCC2CCN(CC(F)(F)F)CC2)CC1.I |
| InChI | InChI=1S/C18H32F3N5O2.HI/c1-2-28-17(27)26-11-6-15(7-12-26)24-16(22)23-8-3-14-4-9-25(10-5-14)13-18(19,20)21;/h14-15H,2-13H2,1H3,(H3,22,23,24);1H |
| InChIKey | VWHNQVONSLQCPZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|