C18H20ClIN4O2 — CID 111823642
1-(3-chloro-4-methoxyphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111823642) has the molecular formula C18H20ClIN4O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823642 |
| Molecular Formula | C18H20ClIN4O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC2CC(=O)Nc3ccccc32)cc1Cl.I |
| InChI | InChI=1S/C18H19ClN4O2.HI/c1-25-16-7-6-12(9-14(16)19)22-18(20)21-10-11-8-17(24)23-15-5-3-2-4-13(11)15;/h2-7,9,11H,8,10H2,1H3,(H,23,24)(H3,20,21,22);1H |
| InChIKey | SNRTXBZWSGAWCZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|