C21H26N4O — CID 111823665
1-(4-butan-2-ylphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine (PubChem CID 111823665) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111823665 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)methyl]guanidine |
| SMILES | CCC(C)c1ccc(N/C(N)=N/CC2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-3-14(2)15-8-10-17(11-9-15)24-21(22)23-13-16-12-20(26)25-19-7-5-4-6-18(16)19/h4-11,14,16H,3,12-13H2,1-2H3,(H,25,26)(H3,22,23,24) |
| InChIKey | DIRDEFHVYYUJFZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|