C16H21N3O3S — CID 111823941
1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine (PubChem CID 111823941) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111823941 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC(C)(O)c2ccsc2)cc1OC |
| InChI | InChI=1S/C16H21N3O3S/c1-16(20,11-6-7-23-9-11)10-18-15(17)19-12-4-5-13(21-2)14(8-12)22-3/h4-9,20H,10H2,1-3H3,(H3,17,18,19) |
| InChIKey | PFKCMTAPIXREST-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|