C16H22IN3O3S — CID 111823940
1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111823940) has the molecular formula C16H22IN3O3S and a molecular weight of 463.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823940 |
| Molecular Formula | C16H22IN3O3S |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(2-hydroxy-2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC(C)(O)c2ccsc2)cc1OC.I |
| InChI | InChI=1S/C16H21N3O3S.HI/c1-16(20,11-6-7-23-9-11)10-18-15(17)19-12-4-5-13(21-2)14(8-12)22-3;/h4-9,20H,10H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | HJAMPEDIAVWJOM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|