C19H25NO2 — CID 111825010
4-methoxy-3-methyl-3-[(3-phenylphenyl)methylamino]butan-1-ol (PubChem CID 111825010) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 4-methoxy-3-methyl-3-[(3-phenylphenyl)methylamino]butan-1-ol.
| Compound Name | 4-methoxy-3-methyl-3-[(3-phenylphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 111825010 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 4-methoxy-3-methyl-3-[(3-phenylphenyl)methylamino]butan-1-ol |
| SMILES | COCC(C)(CCO)NCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO2/c1-19(11-12-21,15-22-2)20-14-16-7-6-10-18(13-16)17-8-4-3-5-9-17/h3-10,13,20-21H,11-12,14-15H2,1-2H3 |
| InChIKey | GEOKHWYYYCNXGL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |