C14H22BrNO2 — CID 97326368
(3S)-3-[(2-bromo-4-methylphenyl)methylamino]-4-methoxy-3-methylbutan-1-ol (PubChem CID 97326368) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is (3S)-3-[(2-bromo-4-methylphenyl)methylamino]-4-methoxy-3-methylbutan-1-ol.
| Compound Name | (3S)-3-[(2-bromo-4-methylphenyl)methylamino]-4-methoxy-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 97326368 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (3S)-3-[(2-bromo-4-methylphenyl)methylamino]-4-methoxy-3-methylbutan-1-ol |
| SMILES | COC[C@](C)(CCO)NCc1ccc(C)cc1Br |
| InChI | InChI=1S/C14H22BrNO2/c1-11-4-5-12(13(15)8-11)9-16-14(2,6-7-17)10-18-3/h4-5,8,16-17H,6-7,9-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | RNAVWYVMWJSCJA-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |