C15H27N3O2S — CID 111831066
2-(2-tert-butylsulfinylethyl)-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 111831066) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111831066 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)C(C)(C)C)NCCc1ccco1 |
| InChI | InChI=1S/C15H27N3O2S/c1-5-16-14(17-9-8-13-7-6-11-20-13)18-10-12-21(19)15(2,3)4/h6-7,11H,5,8-10,12H2,1-4H3,(H2,16,17,18) |
| InChIKey | KQORZUQGTQQBCD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|