C19H29FIN3O2 — CID 111831295
cyclopentyl 4-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 111831295) has the molecular formula C19H29FIN3O2 and a molecular weight of 477.36 g/mol. Its IUPAC name is cyclopentyl 4-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | cyclopentyl 4-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111831295 |
| Molecular Formula | C19H29FIN3O2 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | cyclopentyl 4-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)OC1CCCC1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C19H28FN3O2.HI/c1-21-19(23-14-12-15-7-2-5-10-17(15)20)22-13-6-11-18(24)25-16-8-3-4-9-16;/h2,5,7,10,16H,3-4,6,8-9,11-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | CEXILPKRWKZQNF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|