C18H27ClIN3O2 — CID 111827534
cyclopentyl 4-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 111827534) has the molecular formula C18H27ClIN3O2 and a molecular weight of 479.79 g/mol. Its IUPAC name is cyclopentyl 4-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | cyclopentyl 4-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111827534 |
| Molecular Formula | C18H27ClIN3O2 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | cyclopentyl 4-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)OC1CCCC1)NCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H26ClN3O2.HI/c1-20-18(22-13-14-8-10-15(19)11-9-14)21-12-4-7-17(23)24-16-5-2-3-6-16;/h8-11,16H,2-7,12-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | JXRLUAPYABPSMW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|