C21H29N5O2S — CID 111831649
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111831649) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111831649 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1csc(N2CCCC2)n1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29N5O2S/c1-2-22-20(23-9-7-16-5-6-18-19(13-16)28-15-27-18)24-10-8-17-14-29-21(25-17)26-11-3-4-12-26/h5-6,13-14H,2-4,7-12,15H2,1H3,(H2,22,23,24) |
| InChIKey | YYZQGFFOBNDQAS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|