C14H29IN4O2 — CID 111831691
N-tert-butyl-2-[[ethylamino-[(3-methyloxetan-3-yl)methylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111831691) has the molecular formula C14H29IN4O2 and a molecular weight of 412.32 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[(3-methyloxetan-3-yl)methylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[(3-methyloxetan-3-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111831691 |
| Molecular Formula | C14H29IN4O2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[(3-methyloxetan-3-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC1(C)COC1.I |
| InChI | InChI=1S/C14H28N4O2.HI/c1-6-15-12(17-8-14(5)9-20-10-14)16-7-11(19)18-13(2,3)4;/h6-10H2,1-5H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | DCKZURUJHZCIAK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|