C21H30N4O2S — CID 111832949
2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 111832949) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111832949 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-1-ethyl-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc2c(cc1OCC)CC(C)O2)NCc1csc(CC)n1 |
| InChI | InChI=1S/C21H30N4O2S/c1-5-20-25-17(13-28-20)12-24-21(22-6-2)23-11-16-10-19-15(8-14(4)27-19)9-18(16)26-7-3/h9-10,13-14H,5-8,11-12H2,1-4H3,(H2,22,23,24) |
| InChIKey | VVNSXIKHJPKHDK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|