C21H28IN5O — CID 111836314
1-ethyl-2-[(2-methoxyphenyl)methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111836314) has the molecular formula C21H28IN5O and a molecular weight of 493.39 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methoxyphenyl)methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-methoxyphenyl)methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111836314 |
| Molecular Formula | C21H28IN5O |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-ethyl-2-[(2-methoxyphenyl)methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC)NCCc1cn2cccc(C)c2n1.I |
| InChI | InChI=1S/C21H27N5O.HI/c1-4-22-21(24-14-17-9-5-6-10-19(17)27-3)23-12-11-18-15-26-13-7-8-16(2)20(26)25-18;/h5-10,13,15H,4,11-12,14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | VYXPGGPWYGHWFN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|