C22H29FIN5O2S — CID 109446050
1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 109446050) has the molecular formula C22H29FIN5O2S and a molecular weight of 573.48 g/mol. Its IUPAC name is 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109446050 |
| Molecular Formula | C22H29FIN5O2S |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(8-methylimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCCc1cn2cccc(C)c2n1.I |
| InChI | InChI=1S/C22H28FN5O2S.HI/c1-4-24-22(25-10-9-20-14-28-11-5-6-16(2)21(28)27-20)26-13-18-12-19(23)8-7-17(18)15-31(3,29)30;/h5-8,11-12,14H,4,9-10,13,15H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | YTCHXPFJSCBZIQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|