C21H27F3IN3O3 — CID 111837366
2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111837366) has the molecular formula C21H27F3IN3O3 and a molecular weight of 553.36 g/mol. Its IUPAC name is 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837366 |
| Molecular Formula | C21H27F3IN3O3 |
| Molecular Weight | 553.36 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c(OC)cc(OC)cc1OC)NCc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C21H26F3N3O3.HI/c1-25-20(27-13-14-6-5-7-15(10-14)21(22,23)24)26-9-8-17-18(29-3)11-16(28-2)12-19(17)30-4;/h5-7,10-12H,8-9,13H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | BOFKCAKQOZLVAD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|